C13H16BrClN2O2 — CID 106693847
2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(2-chlorofuran-3-yl)ethanol (PubChem CID 106693847) has the molecular formula C13H16BrClN2O2 and a molecular weight of 347.64 g/mol. Its IUPAC name is 2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(2-chlorofuran-3-yl)ethanol.
| Compound Name | 2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(2-chlorofuran-3-yl)ethanol |
|---|---|
| PubChem CID | 106693847 |
| Molecular Formula | C13H16BrClN2O2 |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(2-chlorofuran-3-yl)ethanol |
| SMILES | CCc1nn(CC)c(CC(O)c2ccoc2Cl)c1Br |
| InChI | InChI=1S/C13H16BrClN2O2/c1-3-9-12(14)10(17(4-2)16-9)7-11(18)8-5-6-19-13(8)15/h5-6,11,18H,3-4,7H2,1-2H3 |
| InChIKey | ANHLVEKQCSYSJW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |