C15H17Br2ClN2O — CID 107947613
1-(3-bromo-5-chlorophenyl)-2-(4-bromo-1,3-diethylpyrazol-5-yl)ethanol (PubChem CID 107947613) has the molecular formula C15H17Br2ClN2O and a molecular weight of 436.58 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-2-(4-bromo-1,3-diethylpyrazol-5-yl)ethanol.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-2-(4-bromo-1,3-diethylpyrazol-5-yl)ethanol |
|---|---|
| PubChem CID | 107947613 |
| Molecular Formula | C15H17Br2ClN2O |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 433.94 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-2-(4-bromo-1,3-diethylpyrazol-5-yl)ethanol |
| SMILES | CCc1nn(CC)c(CC(O)c2cc(Cl)cc(Br)c2)c1Br |
| InChI | InChI=1S/C15H17Br2ClN2O/c1-3-12-15(17)13(20(4-2)19-12)8-14(21)9-5-10(16)7-11(18)6-9/h5-7,14,21H,3-4,8H2,1-2H3 |
| InChIKey | QFJOXMBNWJJYJW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |