C15H18Br2ClN3 — CID 107946095
1-(3-bromo-5-chlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-methylethanamine (PubChem CID 107946095) has the molecular formula C15H18Br2ClN3 and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-methylethanamine.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 107946095 |
| Molecular Formula | C15H18Br2ClN3 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 432.96 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-methylethanamine |
| SMILES | CCc1nn(C)c(CC(NC)c2cc(Cl)cc(Br)c2)c1Br |
| InChI | InChI=1S/C15H18Br2ClN3/c1-4-12-15(17)14(21(3)20-12)8-13(19-2)9-5-10(16)7-11(18)6-9/h5-7,13,19H,4,8H2,1-3H3 |
| InChIKey | FLXHMEZEUZFVAG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |