C14H17Br3N4 — CID 107979192
[2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3,5-dibromophenyl)ethyl]hydrazine (PubChem CID 107979192) has the molecular formula C14H17Br3N4 and a molecular weight of 481.03 g/mol. Its IUPAC name is [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3,5-dibromophenyl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3,5-dibromophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107979192 |
| Molecular Formula | C14H17Br3N4 |
| Molecular Weight | 481.03 g/mol |
| Exact Mass | 477.90 |
| IUPAC Name | [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3,5-dibromophenyl)ethyl]hydrazine |
| SMILES | CCc1nn(C)c(CC(NN)c2cc(Br)cc(Br)c2)c1Br |
| InChI | InChI=1S/C14H17Br3N4/c1-3-11-14(17)13(21(2)20-11)7-12(19-18)8-4-9(15)6-10(16)5-8/h4-6,12,19H,3,7,18H2,1-2H3 |
| InChIKey | YOZXQBWIRFRKIL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.03 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|