C14H17BrClFN4 — CID 105314861
[2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(2-chloro-6-fluorophenyl)ethyl]hydrazine (PubChem CID 105314861) has the molecular formula C14H17BrClFN4 and a molecular weight of 375.67 g/mol. Its IUPAC name is [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(2-chloro-6-fluorophenyl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(2-chloro-6-fluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105314861 |
| Molecular Formula | C14H17BrClFN4 |
| Molecular Weight | 375.67 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(2-chloro-6-fluorophenyl)ethyl]hydrazine |
| SMILES | CCc1nn(C)c(CC(NN)c2c(F)cccc2Cl)c1Br |
| InChI | InChI=1S/C14H17BrClFN4/c1-3-10-14(15)12(21(2)20-10)7-11(19-18)13-8(16)5-4-6-9(13)17/h4-6,11,19H,3,7,18H2,1-2H3 |
| InChIKey | FPRKVSKPFPBZLE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.67 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|