C14H18BrClN4 — CID 107103733
[2-(4-bromo-1,3-dimethylpyrazol-5-yl)-1-(3-chloro-2-methylphenyl)ethyl]hydrazine (PubChem CID 107103733) has the molecular formula C14H18BrClN4 and a molecular weight of 357.68 g/mol. Its IUPAC name is [2-(4-bromo-1,3-dimethylpyrazol-5-yl)-1-(3-chloro-2-methylphenyl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-1,3-dimethylpyrazol-5-yl)-1-(3-chloro-2-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107103733 |
| Molecular Formula | C14H18BrClN4 |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | [2-(4-bromo-1,3-dimethylpyrazol-5-yl)-1-(3-chloro-2-methylphenyl)ethyl]hydrazine |
| SMILES | Cc1nn(C)c(CC(NN)c2cccc(Cl)c2C)c1Br |
| InChI | InChI=1S/C14H18BrClN4/c1-8-10(5-4-6-11(8)16)12(18-17)7-13-14(15)9(2)19-20(13)3/h4-6,12,18H,7,17H2,1-3H3 |
| InChIKey | JWTJMWFUIFSCQT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|