C12H19BrN6 — CID 105264709
[2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-methylimidazol-4-yl)ethyl]hydrazine (PubChem CID 105264709) has the molecular formula C12H19BrN6 and a molecular weight of 327.23 g/mol. Its IUPAC name is [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-methylimidazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-methylimidazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105264709 |
| Molecular Formula | C12H19BrN6 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-methylimidazol-4-yl)ethyl]hydrazine |
| SMILES | CCc1nn(C)c(CC(NN)c2cncn2C)c1Br |
| InChI | InChI=1S/C12H19BrN6/c1-4-8-12(13)10(19(3)17-8)5-9(16-14)11-6-15-7-18(11)2/h6-7,9,16H,4-5,14H2,1-3H3 |
| InChIKey | FDLFJNCYUFMNPH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|