C13H17Br2N3S — CID 104994410
2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-bromothiophen-2-yl)-N-methylethanamine (PubChem CID 104994410) has the molecular formula C13H17Br2N3S and a molecular weight of 407.18 g/mol. Its IUPAC name is 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-bromothiophen-2-yl)-N-methylethanamine.
| Compound Name | 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-bromothiophen-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 104994410 |
| Molecular Formula | C13H17Br2N3S |
| Molecular Weight | 407.18 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(3-bromothiophen-2-yl)-N-methylethanamine |
| SMILES | CCc1nn(C)c(CC(NC)c2sccc2Br)c1Br |
| InChI | InChI=1S/C13H17Br2N3S/c1-4-9-12(15)11(18(3)17-9)7-10(16-2)13-8(14)5-6-19-13/h5-6,10,16H,4,7H2,1-3H3 |
| InChIKey | MIKBMJLURTVNPO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |