C16H24BrN3S — CID 104994601
2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-1-(3-ethylthiophen-2-yl)ethanamine (PubChem CID 104994601) has the molecular formula C16H24BrN3S and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-1-(3-ethylthiophen-2-yl)ethanamine.
| Compound Name | 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-1-(3-ethylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 104994601 |
| Molecular Formula | C16H24BrN3S |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-N-ethyl-1-(3-ethylthiophen-2-yl)ethanamine |
| SMILES | CCNC(Cc1c(Br)c(CC)nn1C)c1sccc1CC |
| InChI | InChI=1S/C16H24BrN3S/c1-5-11-8-9-21-16(11)13(18-7-3)10-14-15(17)12(6-2)19-20(14)4/h8-9,13,18H,5-7,10H2,1-4H3 |
| InChIKey | HPBSPKXWYIILHC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |