C11H19NS — CID 114979794
N-ethyl-1-(3-ethylthiophen-2-yl)propan-1-amine (PubChem CID 114979794) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is N-ethyl-1-(3-ethylthiophen-2-yl)propan-1-amine.
| Compound Name | N-ethyl-1-(3-ethylthiophen-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 114979794 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-ethyl-1-(3-ethylthiophen-2-yl)propan-1-amine |
| SMILES | CCNC(CC)c1sccc1CC |
| InChI | InChI=1S/C11H19NS/c1-4-9-7-8-13-11(9)10(5-2)12-6-3/h7-8,10,12H,4-6H2,1-3H3 |
| InChIKey | BLEHKSWHKVBSGL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |