C14H25ClN4 — CID 107005746
[2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(2,2-dimethylcyclopropyl)ethyl]hydrazine (PubChem CID 107005746) has the molecular formula C14H25ClN4 and a molecular weight of 284.83 g/mol. Its IUPAC name is [2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(2,2-dimethylcyclopropyl)ethyl]hydrazine.
| Compound Name | [2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(2,2-dimethylcyclopropyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107005746 |
| Molecular Formula | C14H25ClN4 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | [2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(2,2-dimethylcyclopropyl)ethyl]hydrazine |
| SMILES | CCc1nn(CC)c(CC(NN)C2CC2(C)C)c1Cl |
| InChI | InChI=1S/C14H25ClN4/c1-5-10-13(15)12(19(6-2)18-10)7-11(17-16)9-8-14(9,3)4/h9,11,17H,5-8,16H2,1-4H3 |
| InChIKey | AUCAVMFLUVZPLM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|