C14H26ClN5S — CID 106446499
[2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine (PubChem CID 106446499) has the molecular formula C14H26ClN5S and a molecular weight of 331.92 g/mol. Its IUPAC name is [2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106446499 |
| Molecular Formula | C14H26ClN5S |
| Molecular Weight | 331.92 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [2-(4-chloro-1,3-diethylpyrazol-5-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine |
| SMILES | CCc1nn(CC)c(CC(NN)C2CSCCN2C)c1Cl |
| InChI | InChI=1S/C14H26ClN5S/c1-4-10-14(15)12(20(5-2)18-10)8-11(17-16)13-9-21-7-6-19(13)3/h11,13,17H,4-9,16H2,1-3H3 |
| InChIKey | AGZQUGVIFRZRFT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.92 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|