C14H25ClN4O — CID 105198758
[1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-(oxolan-2-yl)propan-2-yl]hydrazine (PubChem CID 105198758) has the molecular formula C14H25ClN4O and a molecular weight of 300.83 g/mol. Its IUPAC name is [1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-(oxolan-2-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-(oxolan-2-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105198758 |
| Molecular Formula | C14H25ClN4O |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | [1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-(oxolan-2-yl)propan-2-yl]hydrazine |
| SMILES | CCc1nn(CC)c(CC(CC2CCCO2)NN)c1Cl |
| InChI | InChI=1S/C14H25ClN4O/c1-3-12-14(15)13(19(4-2)18-12)9-10(17-16)8-11-6-5-7-20-11/h10-11,17H,3-9,16H2,1-2H3 |
| InChIKey | KVNULKDKMULZLL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|