C15H30ClN5 — CID 105244212
4-(4-chloro-1,3-diethylpyrazol-5-yl)-N,N-diethyl-3-hydrazinylbutan-1-amine (PubChem CID 105244212) has the molecular formula C15H30ClN5 and a molecular weight of 315.89 g/mol. Its IUPAC name is 4-(4-chloro-1,3-diethylpyrazol-5-yl)-N,N-diethyl-3-hydrazinylbutan-1-amine.
| Compound Name | 4-(4-chloro-1,3-diethylpyrazol-5-yl)-N,N-diethyl-3-hydrazinylbutan-1-amine |
|---|---|
| PubChem CID | 105244212 |
| Molecular Formula | C15H30ClN5 |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 4-(4-chloro-1,3-diethylpyrazol-5-yl)-N,N-diethyl-3-hydrazinylbutan-1-amine |
| SMILES | CCc1nn(CC)c(CC(CCN(CC)CC)NN)c1Cl |
| InChI | InChI=1S/C15H30ClN5/c1-5-13-15(16)14(21(8-4)19-13)11-12(18-17)9-10-20(6-2)7-3/h12,18H,5-11,17H2,1-4H3 |
| InChIKey | LHKNACOYUMWBJE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|