C12H22ClN3O — CID 79616081
1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-methoxybutan-2-amine (PubChem CID 79616081) has the molecular formula C12H22ClN3O and a molecular weight of 259.78 g/mol. Its IUPAC name is 1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-methoxybutan-2-amine.
| Compound Name | 1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-methoxybutan-2-amine |
|---|---|
| PubChem CID | 79616081 |
| Molecular Formula | C12H22ClN3O |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-methoxybutan-2-amine |
| SMILES | CCc1nn(CC)c(CC(N)C(C)OC)c1Cl |
| InChI | InChI=1S/C12H22ClN3O/c1-5-10-12(13)11(16(6-2)15-10)7-9(14)8(3)17-4/h8-9H,5-7,14H2,1-4H3 |
| InChIKey | KTPDLVBXRAUGRM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |