C14H26ClN3O — CID 116717592
1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-ethoxyhexan-2-amine (PubChem CID 116717592) has the molecular formula C14H26ClN3O and a molecular weight of 287.83 g/mol. Its IUPAC name is 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-ethoxyhexan-2-amine.
| Compound Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-ethoxyhexan-2-amine |
|---|---|
| PubChem CID | 116717592 |
| Molecular Formula | C14H26ClN3O |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-ethoxyhexan-2-amine |
| SMILES | CCCC(OCC)C(N)Cc1c(Cl)c(CC)nn1C |
| InChI | InChI=1S/C14H26ClN3O/c1-5-8-13(19-7-3)10(16)9-12-14(15)11(6-2)17-18(12)4/h10,13H,5-9,16H2,1-4H3 |
| InChIKey | FKELBSVUDUKIDY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |