C14H27ClN4O — CID 105271455
[1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-ethoxyhexan-2-yl]hydrazine (PubChem CID 105271455) has the molecular formula C14H27ClN4O and a molecular weight of 302.85 g/mol. Its IUPAC name is [1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-ethoxyhexan-2-yl]hydrazine.
| Compound Name | [1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-ethoxyhexan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105271455 |
| Molecular Formula | C14H27ClN4O |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-ethoxyhexan-2-yl]hydrazine |
| SMILES | CCCC(OCC)C(Cc1c(Cl)c(CC)nn1C)NN |
| InChI | InChI=1S/C14H27ClN4O/c1-5-8-13(20-7-3)11(17-16)9-12-14(15)10(6-2)18-19(12)4/h11,13,17H,5-9,16H2,1-4H3 |
| InChIKey | SOFPZMAQYGTQDH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|