C11H18ClF3N4O — CID 103217584
[1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine (PubChem CID 103217584) has the molecular formula C11H18ClF3N4O and a molecular weight of 314.74 g/mol. Its IUPAC name is [1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103217584 |
| Molecular Formula | C11H18ClF3N4O |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine |
| SMILES | CCc1nn(C)c(CC(COCC(F)(F)F)NN)c1Cl |
| InChI | InChI=1S/C11H18ClF3N4O/c1-3-8-10(12)9(19(2)18-8)4-7(17-16)5-20-6-11(13,14)15/h7,17H,3-6,16H2,1-2H3 |
| InChIKey | BZSNSDYDIKRTIM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|