C11H17ClF4N4O — CID 103477685
[1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine (PubChem CID 103477685) has the molecular formula C11H17ClF4N4O and a molecular weight of 332.73 g/mol. Its IUPAC name is [1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477685 |
| Molecular Formula | C11H17ClF4N4O |
| Molecular Weight | 332.73 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | [1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
| SMILES | Cc1nn(C)c(Cl)c1CC(COCC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C11H17ClF4N4O/c1-6-8(9(12)20(2)19-6)3-7(18-17)4-21-5-11(15,16)10(13)14/h7,10,18H,3-5,17H2,1-2H3 |
| InChIKey | XEJVYXIJHAFQPT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.73 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|