C12H14ClF5N2O — CID 103477829
[1-(2-chloro-6-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine (PubChem CID 103477829) has the molecular formula C12H14ClF5N2O and a molecular weight of 332.70 g/mol. Its IUPAC name is [1-(2-chloro-6-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(2-chloro-6-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477829 |
| Molecular Formula | C12H14ClF5N2O |
| Molecular Weight | 332.70 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | [1-(2-chloro-6-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
| SMILES | NNC(COCC(F)(F)C(F)F)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C12H14ClF5N2O/c13-9-2-1-3-10(14)8(9)4-7(20-19)5-21-6-12(17,18)11(15)16/h1-3,7,11,20H,4-6,19H2 |
| InChIKey | CAJSOXUYAHOFSZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.70 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|