C10H14F4N2OS — CID 103477736
[1-(2,2,3,3-tetrafluoropropoxy)-3-thiophen-3-ylpropan-2-yl]hydrazine (PubChem CID 103477736) has the molecular formula C10H14F4N2OS and a molecular weight of 286.29 g/mol. Its IUPAC name is [1-(2,2,3,3-tetrafluoropropoxy)-3-thiophen-3-ylpropan-2-yl]hydrazine.
| Compound Name | [1-(2,2,3,3-tetrafluoropropoxy)-3-thiophen-3-ylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477736 |
| Molecular Formula | C10H14F4N2OS |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [1-(2,2,3,3-tetrafluoropropoxy)-3-thiophen-3-ylpropan-2-yl]hydrazine |
| SMILES | NNC(COCC(F)(F)C(F)F)Cc1ccsc1 |
| InChI | InChI=1S/C10H14F4N2OS/c11-9(12)10(13,14)6-17-4-8(16-15)3-7-1-2-18-5-7/h1-2,5,8-9,16H,3-4,6,15H2 |
| InChIKey | CMHVKAXZOCVRIX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|