C8H14N2S — CID 105201099
1-thiophen-3-ylbutan-2-ylhydrazine (PubChem CID 105201099) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 1-thiophen-3-ylbutan-2-ylhydrazine.
| Compound Name | 1-thiophen-3-ylbutan-2-ylhydrazine |
|---|---|
| PubChem CID | 105201099 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-thiophen-3-ylbutan-2-ylhydrazine |
| SMILES | CCC(Cc1ccsc1)NN |
| InChI | InChI=1S/C8H14N2S/c1-2-8(10-9)5-7-3-4-11-6-7/h3-4,6,8,10H,2,5,9H2,1H3 |
| InChIKey | YECVGVYOJFPAGG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|