C11H20N2O2S — CID 105246462
(1,1-diethoxy-3-thiophen-3-ylpropan-2-yl)hydrazine (PubChem CID 105246462) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is (1,1-diethoxy-3-thiophen-3-ylpropan-2-yl)hydrazine.
| Compound Name | (1,1-diethoxy-3-thiophen-3-ylpropan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105246462 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (1,1-diethoxy-3-thiophen-3-ylpropan-2-yl)hydrazine |
| SMILES | CCOC(OCC)C(Cc1ccsc1)NN |
| InChI | InChI=1S/C11H20N2O2S/c1-3-14-11(15-4-2)10(13-12)7-9-5-6-16-8-9/h5-6,8,10-11,13H,3-4,7,12H2,1-2H3 |
| InChIKey | DJGVBJJDVVURDQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|