C13H20Cl2N2O2 — CID 105246265
[3-(2,6-dichlorophenyl)-1,1-diethoxypropan-2-yl]hydrazine (PubChem CID 105246265) has the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.22 g/mol. Its IUPAC name is [3-(2,6-dichlorophenyl)-1,1-diethoxypropan-2-yl]hydrazine.
| Compound Name | [3-(2,6-dichlorophenyl)-1,1-diethoxypropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105246265 |
| Molecular Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [3-(2,6-dichlorophenyl)-1,1-diethoxypropan-2-yl]hydrazine |
| SMILES | CCOC(OCC)C(Cc1c(Cl)cccc1Cl)NN |
| InChI | InChI=1S/C13H20Cl2N2O2/c1-3-18-13(19-4-2)12(17-16)8-9-10(14)6-5-7-11(9)15/h5-7,12-13,17H,3-4,8,16H2,1-2H3 |
| InChIKey | DTUVSOKLGVZBSL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|