C10H10Cl2N2 — CID 105209754
1-(2,6-dichlorophenyl)but-3-yn-2-ylhydrazine (PubChem CID 105209754) has the molecular formula C10H10Cl2N2 and a molecular weight of 229.11 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)but-3-yn-2-ylhydrazine.
| Compound Name | 1-(2,6-dichlorophenyl)but-3-yn-2-ylhydrazine |
|---|---|
| PubChem CID | 105209754 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 1-(2,6-dichlorophenyl)but-3-yn-2-ylhydrazine |
| SMILES | C#CC(Cc1c(Cl)cccc1Cl)NN |
| InChI | InChI=1S/C10H10Cl2N2/c1-2-7(14-13)6-8-9(11)4-3-5-10(8)12/h1,3-5,7,14H,6,13H2 |
| InChIKey | AXZDCOXPJPHAQH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|