C15H20Cl2N2 — CID 114190753
[1-(2,6-dichlorophenyl)-6,6-dimethylhept-4-yn-2-yl]hydrazine (PubChem CID 114190753) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.25 g/mol. Its IUPAC name is [1-(2,6-dichlorophenyl)-6,6-dimethylhept-4-yn-2-yl]hydrazine.
| Compound Name | [1-(2,6-dichlorophenyl)-6,6-dimethylhept-4-yn-2-yl]hydrazine |
|---|---|
| PubChem CID | 114190753 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | [1-(2,6-dichlorophenyl)-6,6-dimethylhept-4-yn-2-yl]hydrazine |
| SMILES | CC(C)(C)C#CCC(Cc1c(Cl)cccc1Cl)NN |
| InChI | InChI=1S/C15H20Cl2N2/c1-15(2,3)9-5-6-11(19-18)10-12-13(16)7-4-8-14(12)17/h4,7-8,11,19H,6,10,18H2,1-3H3 |
| InChIKey | VXKHSSWDJZHRQQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|