C10H14ClFN2S — CID 105213730
[1-(2-chloro-6-fluorophenyl)-3-methylsulfanylpropan-2-yl]hydrazine (PubChem CID 105213730) has the molecular formula C10H14ClFN2S and a molecular weight of 248.75 g/mol. Its IUPAC name is [1-(2-chloro-6-fluorophenyl)-3-methylsulfanylpropan-2-yl]hydrazine.
| Compound Name | [1-(2-chloro-6-fluorophenyl)-3-methylsulfanylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105213730 |
| Molecular Formula | C10H14ClFN2S |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | [1-(2-chloro-6-fluorophenyl)-3-methylsulfanylpropan-2-yl]hydrazine |
| SMILES | CSCC(Cc1c(F)cccc1Cl)NN |
| InChI | InChI=1S/C10H14ClFN2S/c1-15-6-7(14-13)5-8-9(11)3-2-4-10(8)12/h2-4,7,14H,5-6,13H2,1H3 |
| InChIKey | NULJDVBPCIAZQR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|