C14H22ClFN2 — CID 105215968
[1-(2-chloro-6-fluorophenyl)-4-methylheptan-2-yl]hydrazine (PubChem CID 105215968) has the molecular formula C14H22ClFN2 and a molecular weight of 272.79 g/mol. Its IUPAC name is [1-(2-chloro-6-fluorophenyl)-4-methylheptan-2-yl]hydrazine.
| Compound Name | [1-(2-chloro-6-fluorophenyl)-4-methylheptan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105215968 |
| Molecular Formula | C14H22ClFN2 |
| Molecular Weight | 272.79 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [1-(2-chloro-6-fluorophenyl)-4-methylheptan-2-yl]hydrazine |
| SMILES | CCCC(C)CC(Cc1c(F)cccc1Cl)NN |
| InChI | InChI=1S/C14H22ClFN2/c1-3-5-10(2)8-11(18-17)9-12-13(15)6-4-7-14(12)16/h4,6-7,10-11,18H,3,5,8-9,17H2,1-2H3 |
| InChIKey | KVNCNDKNGGLNDM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|