C20H14Cl4O — CID 87557848
1,3-dichloro-2-[2-[1-(2,6-dichlorophenyl)but-3-yn-2-yloxy]but-3-ynyl]benzene (PubChem CID 87557848) has the molecular formula C20H14Cl4O and a molecular weight of 412.14 g/mol. Its IUPAC name is 1,3-dichloro-2-[2-[1-(2,6-dichlorophenyl)but-3-yn-2-yloxy]but-3-ynyl]benzene.
| Compound Name | 1,3-dichloro-2-[2-[1-(2,6-dichlorophenyl)but-3-yn-2-yloxy]but-3-ynyl]benzene |
|---|---|
| PubChem CID | 87557848 |
| Molecular Formula | C20H14Cl4O |
| Molecular Weight | 412.14 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | 1,3-dichloro-2-[2-[1-(2,6-dichlorophenyl)but-3-yn-2-yloxy]but-3-ynyl]benzene |
| SMILES | C#CC(Cc1c(Cl)cccc1Cl)OC(C#C)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H14Cl4O/c1-3-13(11-15-17(21)7-5-8-18(15)22)25-14(4-2)12-16-19(23)9-6-10-20(16)24/h1-2,5-10,13-14H,11-12H2 |
| InChIKey | LQDVREQJABQATQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.14 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|