C12H24N4O2 — CID 105246299
[1,1-diethoxy-3-(1-ethylpyrazol-4-yl)propan-2-yl]hydrazine (PubChem CID 105246299) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is [1,1-diethoxy-3-(1-ethylpyrazol-4-yl)propan-2-yl]hydrazine.
| Compound Name | [1,1-diethoxy-3-(1-ethylpyrazol-4-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105246299 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | [1,1-diethoxy-3-(1-ethylpyrazol-4-yl)propan-2-yl]hydrazine |
| SMILES | CCOC(OCC)C(Cc1cnn(CC)c1)NN |
| InChI | InChI=1S/C12H24N4O2/c1-4-16-9-10(8-14-16)7-11(15-13)12(17-5-2)18-6-3/h8-9,11-12,15H,4-7,13H2,1-3H3 |
| InChIKey | XSTNKQVNAXSCAE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|