C12H24N4O — CID 103025218
[1-(1-ethylpyrazol-4-yl)-4-methoxy-4-methylpentan-2-yl]hydrazine (PubChem CID 103025218) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is [1-(1-ethylpyrazol-4-yl)-4-methoxy-4-methylpentan-2-yl]hydrazine.
| Compound Name | [1-(1-ethylpyrazol-4-yl)-4-methoxy-4-methylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103025218 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | [1-(1-ethylpyrazol-4-yl)-4-methoxy-4-methylpentan-2-yl]hydrazine |
| SMILES | CCn1cc(CC(CC(C)(C)OC)NN)cn1 |
| InChI | InChI=1S/C12H24N4O/c1-5-16-9-10(8-14-16)6-11(15-13)7-12(2,3)17-4/h8-9,11,15H,5-7,13H2,1-4H3 |
| InChIKey | ZLJVDCXCWXCQLI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|