C14H27N5O — CID 105240069
[1-(1-ethylpyrazol-4-yl)-3-methyl-3-morpholin-4-ylbutan-2-yl]hydrazine (PubChem CID 105240069) has the molecular formula C14H27N5O and a molecular weight of 281.40 g/mol. Its IUPAC name is [1-(1-ethylpyrazol-4-yl)-3-methyl-3-morpholin-4-ylbutan-2-yl]hydrazine.
| Compound Name | [1-(1-ethylpyrazol-4-yl)-3-methyl-3-morpholin-4-ylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105240069 |
| Molecular Formula | C14H27N5O |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | [1-(1-ethylpyrazol-4-yl)-3-methyl-3-morpholin-4-ylbutan-2-yl]hydrazine |
| SMILES | CCn1cc(CC(NN)C(C)(C)N2CCOCC2)cn1 |
| InChI | InChI=1S/C14H27N5O/c1-4-19-11-12(10-16-19)9-13(17-15)14(2,3)18-5-7-20-8-6-18/h10-11,13,17H,4-9,15H2,1-3H3 |
| InChIKey | HVSPTCLJEYPSQX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|