C13H22N2S2 — CID 105227893
(1-cyclohexylsulfanyl-3-thiophen-3-ylpropan-2-yl)hydrazine (PubChem CID 105227893) has the molecular formula C13H22N2S2 and a molecular weight of 270.47 g/mol. Its IUPAC name is (1-cyclohexylsulfanyl-3-thiophen-3-ylpropan-2-yl)hydrazine.
| Compound Name | (1-cyclohexylsulfanyl-3-thiophen-3-ylpropan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105227893 |
| Molecular Formula | C13H22N2S2 |
| Molecular Weight | 270.47 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (1-cyclohexylsulfanyl-3-thiophen-3-ylpropan-2-yl)hydrazine |
| SMILES | NNC(CSC1CCCCC1)Cc1ccsc1 |
| InChI | InChI=1S/C13H22N2S2/c14-15-12(8-11-6-7-16-9-11)10-17-13-4-2-1-3-5-13/h6-7,9,12-13,15H,1-5,8,10,14H2 |
| InChIKey | KPAMDRHRIAURSR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|