C16H24N4S — CID 105311732
[1-(1-cyclohexylpyrazol-3-yl)-3-thiophen-3-ylpropan-2-yl]hydrazine (PubChem CID 105311732) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is [1-(1-cyclohexylpyrazol-3-yl)-3-thiophen-3-ylpropan-2-yl]hydrazine.
| Compound Name | [1-(1-cyclohexylpyrazol-3-yl)-3-thiophen-3-ylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105311732 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [1-(1-cyclohexylpyrazol-3-yl)-3-thiophen-3-ylpropan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccsc1)Cc1ccn(C2CCCCC2)n1 |
| InChI | InChI=1S/C16H24N4S/c17-18-15(10-13-7-9-21-12-13)11-14-6-8-20(19-14)16-4-2-1-3-5-16/h6-9,12,15-16,18H,1-5,10-11,17H2 |
| InChIKey | COLRIRYCUVAIDZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|