C13H21F3N4O — CID 103217560
[1-(1-cyclopentylpyrazol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine (PubChem CID 103217560) has the molecular formula C13H21F3N4O and a molecular weight of 306.33 g/mol. Its IUPAC name is [1-(1-cyclopentylpyrazol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(1-cyclopentylpyrazol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103217560 |
| Molecular Formula | C13H21F3N4O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | [1-(1-cyclopentylpyrazol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]hydrazine |
| SMILES | NNC(COCC(F)(F)F)Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C13H21F3N4O/c14-13(15,16)9-21-8-11(18-17)7-10-5-6-20(19-10)12-3-1-2-4-12/h5-6,11-12,18H,1-4,7-9,17H2 |
| InChIKey | XFLPCMBFQVBGMU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|