C12H18F3N3 — CID 64777428
1-(1-cyclopentylpyrazol-3-yl)-4,4,4-trifluorobutan-2-amine (PubChem CID 64777428) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrazol-3-yl)-4,4,4-trifluorobutan-2-amine.
| Compound Name | 1-(1-cyclopentylpyrazol-3-yl)-4,4,4-trifluorobutan-2-amine |
|---|---|
| PubChem CID | 64777428 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(1-cyclopentylpyrazol-3-yl)-4,4,4-trifluorobutan-2-amine |
| SMILES | NC(Cc1ccn(C2CCCC2)n1)CC(F)(F)F |
| InChI | InChI=1S/C12H18F3N3/c13-12(14,15)8-9(16)7-10-5-6-18(17-10)11-3-1-2-4-11/h5-6,9,11H,1-4,7-8,16H2 |
| InChIKey | FXUUIXKPEZXHOR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |