C12H14BrF5N2O — CID 103477886
[1-(3-bromo-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine (PubChem CID 103477886) has the molecular formula C12H14BrF5N2O and a molecular weight of 377.15 g/mol. Its IUPAC name is [1-(3-bromo-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(3-bromo-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477886 |
| Molecular Formula | C12H14BrF5N2O |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | [1-(3-bromo-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
| SMILES | NNC(COCC(F)(F)C(F)F)Cc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C12H14BrF5N2O/c13-8-1-7(2-9(14)4-8)3-10(20-19)5-21-6-12(17,18)11(15)16/h1-2,4,10-11,20H,3,5-6,19H2 |
| InChIKey | XNAXTOJHYJOHCQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|