C10H13BrF4N2OS — CID 103477808
[1-(3-bromothiophen-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine (PubChem CID 103477808) has the molecular formula C10H13BrF4N2OS and a molecular weight of 365.19 g/mol. Its IUPAC name is [1-(3-bromothiophen-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(3-bromothiophen-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477808 |
| Molecular Formula | C10H13BrF4N2OS |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | [1-(3-bromothiophen-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
| SMILES | NNC(COCC(F)(F)C(F)F)Cc1sccc1Br |
| InChI | InChI=1S/C10H13BrF4N2OS/c11-7-1-2-19-8(7)3-6(17-16)4-18-5-10(14,15)9(12)13/h1-2,6,9,17H,3-5,16H2 |
| InChIKey | ABBMDPIDVSNSNV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|