C9H16BrN3S — CID 105244859
3-(3-bromothiophen-2-yl)-2-hydrazinyl-N,N-dimethylpropan-1-amine (PubChem CID 105244859) has the molecular formula C9H16BrN3S and a molecular weight of 278.22 g/mol. Its IUPAC name is 3-(3-bromothiophen-2-yl)-2-hydrazinyl-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-bromothiophen-2-yl)-2-hydrazinyl-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 105244859 |
| Molecular Formula | C9H16BrN3S |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 3-(3-bromothiophen-2-yl)-2-hydrazinyl-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC(Cc1sccc1Br)NN |
| InChI | InChI=1S/C9H16BrN3S/c1-13(2)6-7(12-11)5-9-8(10)3-4-14-9/h3-4,7,12H,5-6,11H2,1-2H3 |
| InChIKey | JNRRUCGPOCPITK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|