C11H20BrN3S — CID 105239061
4-(3-bromothiophen-2-yl)-3-hydrazinyl-N,N,2-trimethylbutan-2-amine (PubChem CID 105239061) has the molecular formula C11H20BrN3S and a molecular weight of 306.27 g/mol. Its IUPAC name is 4-(3-bromothiophen-2-yl)-3-hydrazinyl-N,N,2-trimethylbutan-2-amine.
| Compound Name | 4-(3-bromothiophen-2-yl)-3-hydrazinyl-N,N,2-trimethylbutan-2-amine |
|---|---|
| PubChem CID | 105239061 |
| Molecular Formula | C11H20BrN3S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-(3-bromothiophen-2-yl)-3-hydrazinyl-N,N,2-trimethylbutan-2-amine |
| SMILES | CN(C)C(C)(C)C(Cc1sccc1Br)NN |
| InChI | InChI=1S/C11H20BrN3S/c1-11(2,15(3)4)10(14-13)7-9-8(12)5-6-16-9/h5-6,10,14H,7,13H2,1-4H3 |
| InChIKey | CFPDYKYJSMRDNU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|