C12H15F5N2O — CID 103477642
[1-(2-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine (PubChem CID 103477642) has the molecular formula C12H15F5N2O and a molecular weight of 298.25 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(2-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477642 |
| Molecular Formula | C12H15F5N2O |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [1-(2-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
| SMILES | NNC(COCC(F)(F)C(F)F)Cc1ccccc1F |
| InChI | InChI=1S/C12H15F5N2O/c13-10-4-2-1-3-8(10)5-9(19-18)6-20-7-12(16,17)11(14)15/h1-4,9,11,19H,5-7,18H2 |
| InChIKey | USHWQCNMFSNQFF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|