C12H19FN2 — CID 105206821
1-(2-fluorophenyl)hexan-2-ylhydrazine (PubChem CID 105206821) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-(2-fluorophenyl)hexan-2-ylhydrazine.
| Compound Name | 1-(2-fluorophenyl)hexan-2-ylhydrazine |
|---|---|
| PubChem CID | 105206821 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-(2-fluorophenyl)hexan-2-ylhydrazine |
| SMILES | CCCCC(Cc1ccccc1F)NN |
| InChI | InChI=1S/C12H19FN2/c1-2-3-7-11(15-14)9-10-6-4-5-8-12(10)13/h4-6,8,11,15H,2-3,7,9,14H2,1H3 |
| InChIKey | QDHYGUPGNFKACV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|