C14H23F2N3 — CID 105244189
4-(2,3-difluorophenyl)-N,N-diethyl-3-hydrazinylbutan-1-amine (PubChem CID 105244189) has the molecular formula C14H23F2N3 and a molecular weight of 271.35 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)-N,N-diethyl-3-hydrazinylbutan-1-amine.
| Compound Name | 4-(2,3-difluorophenyl)-N,N-diethyl-3-hydrazinylbutan-1-amine |
|---|---|
| PubChem CID | 105244189 |
| Molecular Formula | C14H23F2N3 |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 4-(2,3-difluorophenyl)-N,N-diethyl-3-hydrazinylbutan-1-amine |
| SMILES | CCN(CC)CCC(Cc1cccc(F)c1F)NN |
| InChI | InChI=1S/C14H23F2N3/c1-3-19(4-2)9-8-12(18-17)10-11-6-5-7-13(15)14(11)16/h5-7,12,18H,3-4,8-10,17H2,1-2H3 |
| InChIKey | YJANMVGTQPHVDP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|