C13H16F2N2 — CID 105333380
1-(2,3-difluorophenyl)hept-6-yn-2-ylhydrazine (PubChem CID 105333380) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)hept-6-yn-2-ylhydrazine.
| Compound Name | 1-(2,3-difluorophenyl)hept-6-yn-2-ylhydrazine |
|---|---|
| PubChem CID | 105333380 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-(2,3-difluorophenyl)hept-6-yn-2-ylhydrazine |
| SMILES | C#CCCCC(Cc1cccc(F)c1F)NN |
| InChI | InChI=1S/C13H16F2N2/c1-2-3-4-7-11(17-16)9-10-6-5-8-12(14)13(10)15/h1,5-6,8,11,17H,3-4,7,9,16H2 |
| InChIKey | UKUYEXUCAHRLGB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|