C14H17F2N — CID 105037105
1-(2,3-difluorophenyl)-N-methylhept-5-yn-2-amine (PubChem CID 105037105) has the molecular formula C14H17F2N and a molecular weight of 237.29 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-N-methylhept-5-yn-2-amine.
| Compound Name | 1-(2,3-difluorophenyl)-N-methylhept-5-yn-2-amine |
|---|---|
| PubChem CID | 105037105 |
| Molecular Formula | C14H17F2N |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-(2,3-difluorophenyl)-N-methylhept-5-yn-2-amine |
| SMILES | CC#CCCC(Cc1cccc(F)c1F)NC |
| InChI | InChI=1S/C14H17F2N/c1-3-4-5-8-12(17-2)10-11-7-6-9-13(15)14(11)16/h6-7,9,12,17H,5,8,10H2,1-2H3 |
| InChIKey | DDGFRXNVTOYTLI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|