C14H17Cl2N — CID 104804732
1-(2,4-dichlorophenyl)-N-methylhept-5-yn-2-amine (PubChem CID 104804732) has the molecular formula C14H17Cl2N and a molecular weight of 270.20 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-methylhept-5-yn-2-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-methylhept-5-yn-2-amine |
|---|---|
| PubChem CID | 104804732 |
| Molecular Formula | C14H17Cl2N |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-methylhept-5-yn-2-amine |
| SMILES | CC#CCCC(Cc1ccc(Cl)cc1Cl)NC |
| InChI | InChI=1S/C14H17Cl2N/c1-3-4-5-6-13(17-2)9-11-7-8-12(15)10-14(11)16/h7-8,10,13,17H,5-6,9H2,1-2H3 |
| InChIKey | FCEFBOCEORLSOC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|