C18H21Cl2N — CID 63412977
1-(2,4-dichlorophenyl)-3-(4-ethylphenyl)-N-methylpropan-2-amine (PubChem CID 63412977) has the molecular formula C18H21Cl2N and a molecular weight of 322.28 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(4-ethylphenyl)-N-methylpropan-2-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(4-ethylphenyl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 63412977 |
| Molecular Formula | C18H21Cl2N |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(4-ethylphenyl)-N-methylpropan-2-amine |
| SMILES | CCc1ccc(CC(Cc2ccc(Cl)cc2Cl)NC)cc1 |
| InChI | InChI=1S/C18H21Cl2N/c1-3-13-4-6-14(7-5-13)10-17(21-2)11-15-8-9-16(19)12-18(15)20/h4-9,12,17,21H,3,10-11H2,1-2H3 |
| InChIKey | COYBDKJOWDSZJJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |