C15H23Cl2N — CID 83161129
1-(2,4-dichlorophenyl)-N,6-dimethylheptan-2-amine (PubChem CID 83161129) has the molecular formula C15H23Cl2N and a molecular weight of 288.26 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N,6-dimethylheptan-2-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-N,6-dimethylheptan-2-amine |
|---|---|
| PubChem CID | 83161129 |
| Molecular Formula | C15H23Cl2N |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N,6-dimethylheptan-2-amine |
| SMILES | CNC(CCCC(C)C)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H23Cl2N/c1-11(2)5-4-6-14(18-3)9-12-7-8-13(16)10-15(12)17/h7-8,10-11,14,18H,4-6,9H2,1-3H3 |
| InChIKey | SXJNZUNQIFTSBY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |