C14H21Cl2N — CID 63401781
3-[(2,4-dichlorophenyl)methyl]-N,4-dimethylpentan-2-amine (PubChem CID 63401781) has the molecular formula C14H21Cl2N and a molecular weight of 274.23 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-N,4-dimethylpentan-2-amine.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-N,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 63401781 |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-N,4-dimethylpentan-2-amine |
| SMILES | CNC(C)C(Cc1ccc(Cl)cc1Cl)C(C)C |
| InChI | InChI=1S/C14H21Cl2N/c1-9(2)13(10(3)17-4)7-11-5-6-12(15)8-14(11)16/h5-6,8-10,13,17H,7H2,1-4H3 |
| InChIKey | FXBXNVOYKQRJOJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |