C13H17Cl2F2NO — CID 103149314
1-(2,4-dichlorophenyl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine (PubChem CID 103149314) has the molecular formula C13H17Cl2F2NO and a molecular weight of 312.19 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 103149314 |
| Molecular Formula | C13H17Cl2F2NO |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine |
| SMILES | CNC(CCOCC(F)F)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2F2NO/c1-18-11(4-5-19-8-13(16)17)6-9-2-3-10(14)7-12(9)15/h2-3,7,11,13,18H,4-6,8H2,1H3 |
| InChIKey | SLHDETYJKVHWDP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|